Benzoic acid,4-chloro-, 3-methylbutyl ester structure
|
Common Name | Benzoic acid,4-chloro-, 3-methylbutyl ester | ||
|---|---|---|---|---|
| CAS Number | 6942-75-2 | Molecular Weight | 226.69900 | |
| Density | 1.102g/cm3 | Boiling Point | 285.6ºC at 760 mmHg | |
| Molecular Formula | C12H15ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.3ºC | |
| Name | 3-methylbutyl 4-chlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.102g/cm3 |
|---|---|
| Boiling Point | 285.6ºC at 760 mmHg |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.69900 |
| Flash Point | 131.3ºC |
| Exact Mass | 226.07600 |
| PSA | 26.30000 |
| LogP | 3.54290 |
| Index of Refraction | 1.508 |
| InChIKey | YBRVJNBUZZRJDV-UHFFFAOYSA-N |
| SMILES | CC(C)CCOC(=O)c1ccc(Cl)cc1 |
| HS Code | 2916399090 |
|---|
|
~50%
Benzoic acid,4-... CAS#:6942-75-2 |
| Literature: Yamamoto, Yoshihiko Advanced Synthesis and Catalysis, 2010 , vol. 352, # 2-3 p. 478 - 492 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Chlorobenzoic acid,3-methylbutyl ester |
| Isopentyl-4-chlor-benzoat |
| Isopentyl 4-chlorobenzoate |