Phenol,2,2'-[1,2-ethanediylbis(nitrilomethylidyne)]bis[4-methyl- (9CI) structure
|
Common Name | Phenol,2,2'-[1,2-ethanediylbis(nitrilomethylidyne)]bis[4-methyl- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6943-13-1 | Molecular Weight | 296.36400 | |
| Density | 1.242g/cm3 | Boiling Point | 503.8ºC at 760mmHg | |
| Molecular Formula | C18H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181ºC | |
| Name | (6Z)-4-methyl-6-[[2-[[(Z)-(3-methyl-6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one |
|---|
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 503.8ºC at 760mmHg |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.36400 |
| Flash Point | 181ºC |
| Exact Mass | 296.15200 |
| PSA | 65.18000 |
| LogP | 3.25260 |
| Index of Refraction | 1.681 |
| InChIKey | WSRQROBNCMXICJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(O)c(C=NCCN=Cc2cc(C)ccc2O)c1 |
|
~92%
Phenol,2,2'-[1,... CAS#:6943-13-1 |
| Literature: Siega, Patrizia; Dreos, Renata; Brancatelli, Giovanna; Zangrando, Ennio; Tavagnacco, Claudio; Vrdoljak, Visnja; Hrenar, Tomica Organometallics, 2014 , vol. 33, # 4 p. 909 - 920 |
|
~%
Phenol,2,2'-[1,... CAS#:6943-13-1 |
| Literature: Liggett; Diehl Proceedings of the Iowa Academy of Science, 1945 , vol. 52, p. 191,195 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |