1-chloro-2-[(2-chlorophenyl)diselanyl]benzene
![1-chloro-2-[(2-chlorophenyl)diselanyl]benzene Structure](https://image.chemsrc.com/caspic/366/69447-35-4.png)
1-chloro-2-[(2-chlorophenyl)diselanyl]benzene structure
|
Common Name | 1-chloro-2-[(2-chlorophenyl)diselanyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 69447-35-4 | Molecular Weight | 381.01800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8Cl2Se2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-chloro-2-[(2-chlorophenyl)diselanyl]benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H8Cl2Se2 |
|---|---|
| Molecular Weight | 381.01800 |
| Exact Mass | 381.83300 |
| LogP | 2.26760 |
| InChIKey | WDHYRGODLWNICS-UHFFFAOYSA-N |
| SMILES | Clc1ccccc1[Se][Se]c1ccccc1Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~91%
1-chloro-2-[(2-... CAS#:69447-35-4 |
| Literature: Singh, Devender; Deobald, Anna M.; Camargo, Leandro R.S.; Tabarelli, Greice; Rodrigues, Oscar E.D.; Braga, Antonio L. Organic Letters, 2010 , vol. 12, # 15 p. 3288 - 3291 |
|
~%
1-chloro-2-[(2-... CAS#:69447-35-4 |
| Literature: Rheinboldt; Giesbrecht Chemische Berichte, 1955 , vol. 88, p. 666,672 Chemische Berichte, 1955 , vol. 88, p. 1974,1976 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2.2'-Dichlor-diphenyldiselenid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-chloro-2-[(2-chlorophenyl)diselanyl]benzene? |
| A: Molecular weight of 1-chloro-2-[(2-chlorophenyl)diselanyl]benzene is 381.01800. |
| Q: What is the SMILES notation of 1-chloro-2-[(2-chlorophenyl)diselanyl]benzene? |
| A: SMILES notation of 1-chloro-2-[(2-chlorophenyl)diselanyl]benzene is Clc1ccccc1[Se][Se]c1ccccc1Cl. |
| Q: What English synonyms does 1-chloro-2-[(2-chlorophenyl)diselanyl]benzene have? |
| A: English synonyms of 1-chloro-2-[(2-chlorophenyl)diselanyl]benzene: 2.2'-Dichlor-diphenyldiselenid. |
| Q: What is the InChIKey of 1-chloro-2-[(2-chlorophenyl)diselanyl]benzene? |
| A: InChIKey of 1-chloro-2-[(2-chlorophenyl)diselanyl]benzene is WDHYRGODLWNICS-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 1-chloro-2-[(2-chlorophenyl)diselanyl]benzene? |
| A: Related upstream materials(CAS) of 1-chloro-2-[(2-chlorophenyl)diselanyl]benzene: 615-41-8;858495-97-3. |
| Q: What is the CAS number of 1-chloro-2-[(2-chlorophenyl)diselanyl]benzene? |
| A: CAS number of 1-chloro-2-[(2-chlorophenyl)diselanyl]benzene is 69447-35-4. |
| Q: What is the molecular formula of 1-chloro-2-[(2-chlorophenyl)diselanyl]benzene? |
| A: Molecular formula of 1-chloro-2-[(2-chlorophenyl)diselanyl]benzene is C12H8Cl2Se2. |
| Q: What is the LogP of 1-chloro-2-[(2-chlorophenyl)diselanyl]benzene? |
| A: LogP of 1-chloro-2-[(2-chlorophenyl)diselanyl]benzene is 2.26760. |
| Q: What is the English name of 1-chloro-2-[(2-chlorophenyl)diselanyl]benzene? |
| A: The English name of 1-chloro-2-[(2-chlorophenyl)diselanyl]benzene is 1-chloro-2-[(2-chlorophenyl)diselanyl]benzene. |
| Q: What is the Chinese name of 69447-35-4? |
| A: Chinese name of 69447-35-4 is 69447-35-4. |