4a,9a-epoxy-4a,9a-dihydroanthracene-1,4,9,10-tetrone structure
|
Common Name | 4a,9a-epoxy-4a,9a-dihydroanthracene-1,4,9,10-tetrone | ||
|---|---|---|---|---|
| CAS Number | 69448-06-2 | Molecular Weight | 254.19400 | |
| Density | 1.65g/cm3 | Boiling Point | 577ºC at 760 mmHg | |
| Molecular Formula | C14H6O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.2ºC | |
| Name | 4a,9a-Epoxyanthracene-1,4,9,10-tetrone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.65g/cm3 |
|---|---|
| Boiling Point | 577ºC at 760 mmHg |
| Molecular Formula | C14H6O5 |
| Molecular Weight | 254.19400 |
| Flash Point | 263.2ºC |
| Exact Mass | 254.02200 |
| PSA | 80.81000 |
| LogP | 0.28140 |
| Index of Refraction | 1.709 |
| InChIKey | GPBFYLLNWWODLE-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=O)C23OC12C(=O)c1ccccc1C3=O |
|
~%
4a,9a-epoxy-4a,... CAS#:69448-06-2 |
| Literature: Chandler; Stoodley Journal of the Chemical Society. Perkin transactions 1, 1980 , vol. 4, p. 1007 - 1012 |
|
~%
4a,9a-epoxy-4a,... CAS#:69448-06-2 |
| Literature: Chandler; Stoodley Journal of the Chemical Society. Perkin transactions 1, 1980 , vol. 4, p. 1007 - 1012 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Edhahc-1,4,9,10-T |
| 4a,9a-epoxy-4a,9a-dihydro-anthracene-1,4,9,10-tetraone |
| 4a,9a-Epoxy-4a,9a-dihydroanthracene-1,4,9,10-tetrone |