3-(2-methylpropyl)-1-(1-thiophen-2-ylethylideneamino)thiourea structure
|
Common Name | 3-(2-methylpropyl)-1-(1-thiophen-2-ylethylideneamino)thiourea | ||
|---|---|---|---|---|
| CAS Number | 6945-22-8 | Molecular Weight | 255.40300 | |
| Density | 1.18g/cm3 | Boiling Point | 351.8ºC at 760 mmHg | |
| Molecular Formula | C11H17N3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.6ºC | |
| Name | 1-(2-methylpropyl)-3-[(Z)-1-thiophen-2-ylethylideneamino]thiourea |
|---|
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 351.8ºC at 760 mmHg |
| Molecular Formula | C11H17N3S2 |
| Molecular Weight | 255.40300 |
| Flash Point | 166.6ºC |
| Exact Mass | 255.08600 |
| PSA | 96.75000 |
| LogP | 3.37400 |
| Index of Refraction | 1.605 |
| InChIKey | XFTPWFPFLXNIIT-LCYFTJDESA-N |
| SMILES | CC(=NNC(=S)NCC(C)C)c1cccs1 |
|
~%
3-(2-methylprop... CAS#:6945-22-8 |
| Literature: Dodgen; Nobles Journal of the American Pharmaceutical Association (1912-1977), 1957 , vol. 46, p. 437 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |