2,4-Imidazolidinedione,5-(3-chlorophenyl)-5-methyl- structure
|
Common Name | 2,4-Imidazolidinedione,5-(3-chlorophenyl)-5-methyl- | ||
|---|---|---|---|---|
| CAS Number | 6946-01-6 | Molecular Weight | 224.64400 | |
| Density | 1.334g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(3-chlorophenyl)-5-methylimidazolidine-2,4-dione |
|---|
| Density | 1.334g/cm3 |
|---|---|
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.64400 |
| Exact Mass | 224.03500 |
| PSA | 58.20000 |
| LogP | 2.05220 |
| Index of Refraction | 1.563 |
| InChIKey | CDAMVXKHZACAKQ-UHFFFAOYSA-N |
| SMILES | CC1(c2cccc(Cl)c2)NC(=O)NC1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |