Aceticacid, 2-[[(4-nitrophenyl)methyl]sulfonyl]-, methyl ester structure
|
Common Name | Aceticacid, 2-[[(4-nitrophenyl)methyl]sulfonyl]-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 6946-16-3 | Molecular Weight | 273.26200 | |
| Density | 1.426g/cm3 | Boiling Point | 511.1ºC at 760mmHg | |
| Molecular Formula | C10H11NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.9ºC | |
| Name | <<(4-nitrophenyl)methyl>sulphonyl>acetic acid methyl ester |
|---|
| Density | 1.426g/cm3 |
|---|---|
| Boiling Point | 511.1ºC at 760mmHg |
| Molecular Formula | C10H11NO6S |
| Molecular Weight | 273.26200 |
| Flash Point | 262.9ºC |
| Exact Mass | 273.03100 |
| PSA | 114.64000 |
| LogP | 2.28660 |
| Index of Refraction | 1.56 |
| InChIKey | CZSPYWSJSORAFP-UHFFFAOYSA-N |
| SMILES | COC(=O)CS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 |
|
~%
Aceticacid, 2-[... CAS#:6946-16-3 |
| Literature: Riad, Y.; Asaad, A. Naguib; Nahas, Hind Moustafa El; Madkour, A. Emad El Din Egyptian Journal of Chemistry, 1994 , vol. 37, # 2 p. 157 - 172 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |