1-[(E)-2-nitroethenyl]-4-propoxy-benzene structure
|
Common Name | 1-[(E)-2-nitroethenyl]-4-propoxy-benzene | ||
|---|---|---|---|---|
| CAS Number | 6946-31-2 | Molecular Weight | 207.22600 | |
| Density | 1.128g/cm3 | Boiling Point | 342.1ºC at 760 mmHg | |
| Molecular Formula | C11H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.4ºC | |
| Name | 1-(2-nitroethenyl)-4-propoxybenzene |
|---|
| Density | 1.128g/cm3 |
|---|---|
| Boiling Point | 342.1ºC at 760 mmHg |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.22600 |
| Flash Point | 152.4ºC |
| Exact Mass | 207.09000 |
| PSA | 55.05000 |
| LogP | 3.24600 |
| Index of Refraction | 1.56 |
| InChIKey | VKWWKOVGOMKAOT-BQYQJAHWSA-N |
| SMILES | CCCOc1ccc(C=C[N+](=O)[O-])cc1 |
|
~60%
1-[(E)-2-nitroe... CAS#:6946-31-2 |
| Literature: Luehr, Susan; Vilches-Herrera, Marcelo; Fierro, Angelica; Ramsay, Rona R.; Edmondson, Dale E.; Reyes-Parada, Miguel; Cassels, Bruce K.; Iturriaga-Vasquez, Patricio Bioorganic and Medicinal Chemistry, 2010 , vol. 18, # 4 p. 1388 - 1395 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |