1-[(E)-2-nitroethenyl]-4-propoxy-benzene
![1-[(E)-2-nitroethenyl]-4-propoxy-benzene Structure](https://image.chemsrc.com/caspic/427/6946-31-2.png)
1-[(E)-2-nitroethenyl]-4-propoxy-benzene structure
|
Common Name | 1-[(E)-2-nitroethenyl]-4-propoxy-benzene | ||
|---|---|---|---|---|
| CAS Number | 6946-31-2 | Molecular Weight | 207.22600 | |
| Density | 1.128g/cm3 | Boiling Point | 342.1ºC at 760 mmHg | |
| Molecular Formula | C11H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2-nitroethenyl)-4-propoxybenzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.128g/cm3 |
|---|---|
| Boiling Point | 342.1ºC at 760 mmHg |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.22600 |
| Flash Point | 152.4ºC |
| Exact Mass | 207.09000 |
| PSA | 55.05000 |
| LogP | 3.24600 |
| Index of Refraction | 1.56 |
| InChIKey | VKWWKOVGOMKAOT-BQYQJAHWSA-N |
| SMILES | CCCOc1ccc(C=C[N+](=O)[O-])cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~60%
1-[(E)-2-nitroe... CAS#:6946-31-2 |
| Literature: Luehr, Susan; Vilches-Herrera, Marcelo; Fierro, Angelica; Ramsay, Rona R.; Edmondson, Dale E.; Reyes-Parada, Miguel; Cassels, Bruce K.; Iturriaga-Vasquez, Patricio Bioorganic and Medicinal Chemistry, 2010 , vol. 18, # 4 p. 1388 - 1395 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-(2-nitroethenyl)-4-propoxybenzene? |
| A: SMILES notation of 1-(2-nitroethenyl)-4-propoxybenzene is CCCOc1ccc(C=C[N+](=O)[O-])cc1. |
| Q: What is the English name of 1-(2-nitroethenyl)-4-propoxybenzene? |
| A: The English name of 1-(2-nitroethenyl)-4-propoxybenzene is 1-(2-nitroethenyl)-4-propoxybenzene. |
| Q: What is the Chinese name of 6946-31-2? |
| A: Chinese name of 6946-31-2 is 6946-31-2. |
| Q: What are the upstream materials of 1-(2-nitroethenyl)-4-propoxybenzene? |
| A: Related upstream materials(CAS) of 1-(2-nitroethenyl)-4-propoxybenzene: 75-52-5;5736-85-6. |
| Q: What is the LogP of 1-(2-nitroethenyl)-4-propoxybenzene? |
| A: LogP of 1-(2-nitroethenyl)-4-propoxybenzene is 3.24600. |
| Q: What is the CAS number of 1-(2-nitroethenyl)-4-propoxybenzene? |
| A: CAS number of 1-(2-nitroethenyl)-4-propoxybenzene is 6946-31-2. |
| Q: What is the boiling point of 1-(2-nitroethenyl)-4-propoxybenzene? |
| A: Boiling point of 1-(2-nitroethenyl)-4-propoxybenzene is 342.1ºC at 760 mmHg. |
| Q: What is the InChIKey of 1-(2-nitroethenyl)-4-propoxybenzene? |
| A: InChIKey of 1-(2-nitroethenyl)-4-propoxybenzene is VKWWKOVGOMKAOT-BQYQJAHWSA-N. |
| Q: What is the polar surface area (PSA) of 1-(2-nitroethenyl)-4-propoxybenzene? |
| A: Polar surface area (PSA) of 1-(2-nitroethenyl)-4-propoxybenzene is 55.05000. |
| Q: What is the molecular weight of 1-(2-nitroethenyl)-4-propoxybenzene? |
| A: Molecular weight of 1-(2-nitroethenyl)-4-propoxybenzene is 207.22600. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |