2-Cyclohexene-1-carboxylicacid, 2-methyl-4-oxo-6-propyl-, ethyl ester structure
|
Common Name | 2-Cyclohexene-1-carboxylicacid, 2-methyl-4-oxo-6-propyl-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 6946-59-4 | Molecular Weight | 224.29600 | |
| Density | 1.008g/cm3 | Boiling Point | 314.2ºC at 760 mmHg | |
| Molecular Formula | C13H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.6ºC | |
| Name | ethyl 2-methyl-4-oxo-6-propylcyclohex-2-ene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.008g/cm3 |
|---|---|
| Boiling Point | 314.2ºC at 760 mmHg |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.29600 |
| Flash Point | 134.6ºC |
| Exact Mass | 224.14100 |
| PSA | 43.37000 |
| LogP | 2.50110 |
| Index of Refraction | 1.466 |
| InChIKey | KDIZYDOQEYHUCP-UHFFFAOYSA-N |
| SMILES | CCCC1CC(=O)C=C(C)C1C(=O)OCC |
|
~90%
2-Cyclohexene-1... CAS#:6946-59-4 |
| Literature: Ramachary, Dhevalapally B.; Ramakumar, Kinthada; Narayana, Vidadala V. Journal of Organic Chemistry, 2007 , vol. 72, # 4 p. 1458 - 1463 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Aethoxycarbonyl-2-methyl-4-propyl-cyclohexen-(1)-on-(6) |
| 2-methyl-4-oxo-6-propylcyclohex-2-enecarboxylic acid ethyl ester |
| 3-Methyl-5-propyl-4-carbethoxy-2-cyclohexen-1-on |
| 2-Methyl-4-oxo-6-propyl-cyclohex-2-encarbonsaeure-aethylester |