methyl 5-(dipropan-2-ylcarbamoyl)pentanoate structure
|
Common Name | methyl 5-(dipropan-2-ylcarbamoyl)pentanoate | ||
|---|---|---|---|---|
| CAS Number | 6946-67-4 | Molecular Weight | 243.34200 | |
| Density | 0.966g/cm3 | Boiling Point | 323.7ºC at 760 mmHg | |
| Molecular Formula | C13H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.6ºC | |
| Name | methyl 6-[di(propan-2-yl)amino]-6-oxohexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.966g/cm3 |
|---|---|
| Boiling Point | 323.7ºC at 760 mmHg |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.34200 |
| Flash Point | 149.6ºC |
| Exact Mass | 243.18300 |
| PSA | 46.61000 |
| LogP | 2.36520 |
| Index of Refraction | 1.45 |
| InChIKey | OKDBCLDDUYQSGA-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCCC(=O)N(C(C)C)C(C)C |
|
~79%
methyl 5-(dipro... CAS#:6946-67-4 |
| Literature: Saito, Yukako; Ouchi, Hidekazu; Takahata, Hiroki Tetrahedron, 2008 , vol. 64, # 49 p. 11129 - 11135 |
|
~90%
methyl 5-(dipro... CAS#:6946-67-4 |
| Literature: LaMontagne, Maurice P.; Dagli, Dinesh; Khan, M. Sami; Blumbergs, Peter Journal of Medicinal Chemistry, 1980 , vol. 23, # 9 p. 981 - 985 |
|
~%
methyl 5-(dipro... CAS#:6946-67-4 |
| Literature: LaMontagne, Maurice P.; Dagli, Dinesh; Khan, M. Sami; Blumbergs, Peter Journal of Medicinal Chemistry, 1980 , vol. 23, # 9 p. 981 - 985 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Adipinsaeure-diisopropylamid-methylester |
| N,N-Diisopropyl-adipamidsaeure-methylester |
| N,N-diisopropyl-adipamic acid methyl ester |