methyl 5-(dipropylcarbamoyl)pentanoate structure
|
Common Name | methyl 5-(dipropylcarbamoyl)pentanoate | ||
|---|---|---|---|---|
| CAS Number | 6946-69-6 | Molecular Weight | 243.34200 | |
| Density | 0.969g/cm3 | Boiling Point | 333.9ºC at 760 mmHg | |
| Molecular Formula | C13H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.7ºC | |
| Name | methyl 6-(dipropylamino)-6-oxohexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.969g/cm3 |
|---|---|
| Boiling Point | 333.9ºC at 760 mmHg |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.34200 |
| Flash Point | 155.7ºC |
| Exact Mass | 243.18300 |
| PSA | 46.61000 |
| LogP | 2.36840 |
| Index of Refraction | 1.452 |
| InChIKey | VLVXCYQXCDTMAR-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)C(=O)CCCCC(=O)OC |
|
~%
methyl 5-(dipro... CAS#:6946-69-6 |
| Literature: Edwards; Lewis; Marren The Journal of pharmacy and pharmacology, 1966 , vol. 18, # 10 p. 670 - 676 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Methyl N,N-dipropyladipamat |