5-(1-adamantyl)-3-methoxy-1,2,4-triazine structure
|
Common Name | 5-(1-adamantyl)-3-methoxy-1,2,4-triazine | ||
|---|---|---|---|---|
| CAS Number | 69466-75-7 | Molecular Weight | 245.32000 | |
| Density | 1.214g/cm3 | Boiling Point | 391.6ºC at 760 mmHg | |
| Molecular Formula | C14H19N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.2ºC | |
| Name | 5-(1-adamantyl)-3-methoxy-1,2,4-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.214g/cm3 |
|---|---|
| Boiling Point | 391.6ºC at 760 mmHg |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.32000 |
| Flash Point | 142.2ºC |
| Exact Mass | 245.15300 |
| PSA | 47.90000 |
| LogP | 2.34800 |
| Index of Refraction | 1.582 |
| InChIKey | SAMMJDJYLVYPGT-UHFFFAOYSA-N |
| SMILES | COc1nncc(C23CC4CC(CC(C4)C2)C3)n1 |
|
~%
5-(1-adamantyl)... CAS#:69466-75-7 |
| Literature: Heilman; Scozzie; Wayner; Gullo; Ariyan Journal of Pharmaceutical Sciences, 1980 , vol. 69, # 3 p. 282 - 287 |
| 3-Methoxy-5-(1'-adamantyl)-1,2,4-triazin |
| 3-methoxy-5-(tricyclo[3.3.1.13,7]dec-1-yl)-1,2,4-triazine |
| as-Triazine,5-(1-adamantyl)-3-methoxy |
| 5-adamantan-1-yl-3-methoxy-[1,2,4]triazine |
| 1,2,4-Triazine,3-methoxy-5-tricyclo(3.3.1.1(sup 3,7))dec-1-yl |
| 5-(1-Adamantyl)-3-methoxy-as-triazine |