5,6-Bis(2-furyl)-3-methylthio-1,2,4-triazine structure
|
Common Name | 5,6-Bis(2-furyl)-3-methylthio-1,2,4-triazine | ||
|---|---|---|---|---|
| CAS Number | 69467-09-0 | Molecular Weight | 259.28400 | |
| Density | 1.41g/cm3 | Boiling Point | 411.7ºC at 760mmHg | |
| Molecular Formula | C12H9N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.8ºC | |
| Name | 5,6-bis(furan-2-yl)-3-methylsulfanyl-1,2,4-triazine |
|---|
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 411.7ºC at 760mmHg |
| Molecular Formula | C12H9N3O2S |
| Molecular Weight | 259.28400 |
| Flash Point | 202.8ºC |
| Exact Mass | 259.04200 |
| PSA | 90.25000 |
| LogP | 3.11350 |
| Index of Refraction | 1.654 |
| InChIKey | SERAYZIPJKSYSO-UHFFFAOYSA-N |
| SMILES | CSc1nnc(-c2ccco2)c(-c2ccco2)n1 |
|
~%
5,6-Bis(2-furyl... CAS#:69467-09-0 |
| Literature: Heilman; Scozzie; Wayner; Gullo; Ariyan Journal of Pharmaceutical Sciences, 1980 , vol. 69, # 3 p. 282 - 287 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |