Androst-4-en-3-one,17-hydroxy-7-[(1-oxopropyl)thio]-, (7a,17b)- (9CI) structure
|
Common Name | Androst-4-en-3-one,17-hydroxy-7-[(1-oxopropyl)thio]-, (7a,17b)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6947-46-2 | Molecular Weight | 376.55300 | |
| Density | 1.18g/cm3 | Boiling Point | 525.1ºC at 760mmHg | |
| Molecular Formula | C22H32O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.4ºC | |
| Name | S-[(7R,8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl] propanethioate |
|---|
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 525.1ºC at 760mmHg |
| Molecular Formula | C22H32O3S |
| Molecular Weight | 376.55300 |
| Flash Point | 271.4ºC |
| Exact Mass | 376.20700 |
| PSA | 79.67000 |
| LogP | 4.52750 |
| Index of Refraction | 1.577 |
| InChIKey | HONIPOFOKOETAA-UHFFFAOYSA-N |
| SMILES | CCC(=O)SC1CC2=CC(=O)CCC2(C)C2CCC3(C)C(O)CCC3C12 |
|
~%
Androst-4-en-3-... CAS#:6947-46-2 |
| Literature: Dodson; Tweit Journal of the American Chemical Society, 1959 , vol. 81, p. 1224,1225 Show Details Searle and Co. Patent: US2859222 , 1957 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |