1-Butanone,3-(1,3-benzodioxol-5-yl)-4-nitro-1-phenyl- structure
|
Common Name | 1-Butanone,3-(1,3-benzodioxol-5-yl)-4-nitro-1-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 6947-83-7 | Molecular Weight | 313.30500 | |
| Density | 1.308g/cm3 | Boiling Point | 517.3ºC at 760 mmHg | |
| Molecular Formula | C17H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.1ºC | |
| Name | 3-(1,3-benzodioxol-5-yl)-4-nitro-1-phenylbutan-1-one |
|---|
| Density | 1.308g/cm3 |
|---|---|
| Boiling Point | 517.3ºC at 760 mmHg |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.30500 |
| Flash Point | 227.1ºC |
| Exact Mass | 313.09500 |
| PSA | 81.35000 |
| LogP | 3.57180 |
| Index of Refraction | 1.602 |
| InChIKey | AXLJDGFVXAWIRM-UHFFFAOYSA-N |
| SMILES | O=C(CC(C[N+](=O)[O-])c1ccc2c(c1)OCO2)c1ccccc1 |
| HS Code | 2932999099 |
|---|
|
~%
1-Butanone,3-(1... CAS#:6947-83-7 |
| Literature: Kloetzel; Pinkus Journal of the American Chemical Society, 1958 , vol. 80, p. 2332 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |