1-(2-hydroxy-4-methoxy-3-phenylmethoxyphenyl)ethanone structure
|
Common Name | 1-(2-hydroxy-4-methoxy-3-phenylmethoxyphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 69471-01-8 | Molecular Weight | 272.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-hydroxy-4-methoxy-3-phenylmethoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H16O4 |
|---|---|
| Molecular Weight | 272.29600 |
| Exact Mass | 272.10500 |
| PSA | 55.76000 |
| LogP | 3.18240 |
| InChIKey | RFWPCVCFCOPKNF-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(C)=O)c(O)c1OCc1ccccc1 |
|
~%
1-(2-hydroxy-4-... CAS#:69471-01-8 |
| Literature: Baker; Evans Journal of the Chemical Society, 1938 , p. 372,374 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-benzyloxy-2-hydroxy-4-methoxy-acetophenone |