N-(benzenesulfonyl)-3,4,5-trimethoxy-benzohydrazide structure
|
Common Name | N-(benzenesulfonyl)-3,4,5-trimethoxy-benzohydrazide | ||
|---|---|---|---|---|
| CAS Number | 6948-63-6 | Molecular Weight | 366.38900 | |
| Density | 1.307g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H18N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N'-(3,4,5-trimethoxybenzoyl)benzenesulfonohydrazide |
|---|
| Density | 1.307g/cm3 |
|---|---|
| Molecular Formula | C16H18N2O6S |
| Molecular Weight | 366.38900 |
| Exact Mass | 366.08900 |
| PSA | 111.34000 |
| LogP | 3.19830 |
| Index of Refraction | 1.566 |
| InChIKey | VIFMYRYDXHXIFE-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)NNS(=O)(=O)c2ccccc2)cc(OC)c1OC |
| HS Code | 2935009090 |
|---|
|
~%
N-(benzenesulfo... CAS#:6948-63-6 |
| Literature: Buchanan; Cook; Loudon Journal of the Chemical Society, 1944 , p. 325,327 |
|
~%
N-(benzenesulfo... CAS#:6948-63-6 |
| Literature: Buchanan; Cook; Loudon Journal of the Chemical Society, 1944 , p. 325,327 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |