4-dibenzofuran-3-ylbutanoic acid structure
|
Common Name | 4-dibenzofuran-3-ylbutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 6948-74-9 | Molecular Weight | 254.28100 | |
| Density | 1.265g/cm3 | Boiling Point | 447.7ºC at 760 mmHg | |
| Molecular Formula | C16H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.6ºC | |
| Name | 4-dibenzofuran-3-ylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.265g/cm3 |
|---|---|
| Boiling Point | 447.7ºC at 760 mmHg |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28100 |
| Flash Point | 224.6ºC |
| Exact Mass | 254.09400 |
| PSA | 50.44000 |
| LogP | 3.99330 |
| Index of Refraction | 1.665 |
| InChIKey | DGNIOFJTLFYLLF-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCc1ccc2c(c1)oc1ccccc12 |
|
~%
4-dibenzofuran-... CAS#:6948-74-9 |
| Literature: Chatterjea Journal of the Indian Chemical Society, 1956 , vol. 33, p. 447,451 Experientia, 1956 , vol. 12, p. 18 |
|
~%
4-dibenzofuran-... CAS#:6948-74-9 |
| Literature: Chatterjea Journal of the Indian Chemical Society, 1956 , vol. 33, p. 447,451 Experientia, 1956 , vol. 12, p. 18 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-dibenzofuran-3-yl-butyric acid |
| 4-(dibenzo[b,d]furan-3-yl)butanoic acid |
| 3-Dibenzofuranbutyric acid |
| 4-Dibenzofuran-3-yl-buttersaeure |