1-naphthoyl isocyanate
Modify Date: 2025-09-30 09:17:32
1-naphthoyl isocyanate structure
|
Common Name | 1-naphthoyl isocyanate | ||
|---|---|---|---|---|
| CAS Number | 69486-52-8 | Molecular Weight | 197.18900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-naphthoyl isocyanate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H7NO2 |
|---|---|
| Molecular Weight | 197.18900 |
| Exact Mass | 197.04800 |
| PSA | 46.50000 |
| LogP | 2.31580 |
| InChIKey | XGOOMNFRIHJVFD-UHFFFAOYSA-N |
| SMILES | O=C=NC(=O)c1ccc2ccccc2c1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-naphthoyl isocyanate |
| Naphthalin-2-carbonylisocyanat |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 69486-52-8? |
| A: Chinese name of 69486-52-8 is 69486-52-8. |
| Q: What is the SMILES notation of 1-naphthoyl isocyanate? |
| A: SMILES notation of 1-naphthoyl isocyanate is O=C=NC(=O)c1ccc2ccccc2c1. |
| Q: What English synonyms does 1-naphthoyl isocyanate have? |
| A: English synonyms of 1-naphthoyl isocyanate: 2-naphthoyl isocyanate, Naphthalin-2-carbonylisocyanat. |
| Q: What is the CAS number of 1-naphthoyl isocyanate? |
| A: CAS number of 1-naphthoyl isocyanate is 69486-52-8. |
| Q: What is the InChIKey of 1-naphthoyl isocyanate? |
| A: InChIKey of 1-naphthoyl isocyanate is XGOOMNFRIHJVFD-UHFFFAOYSA-N. |
| Q: What is the English name of 1-naphthoyl isocyanate? |
| A: The English name of 1-naphthoyl isocyanate is 1-naphthoyl isocyanate. |
| Q: What is the molecular formula of 1-naphthoyl isocyanate? |
| A: Molecular formula of 1-naphthoyl isocyanate is C12H7NO2. |
| Q: What is the polar surface area (PSA) of 1-naphthoyl isocyanate? |
| A: Polar surface area (PSA) of 1-naphthoyl isocyanate is 46.50000. |
| Q: What is the LogP of 1-naphthoyl isocyanate? |
| A: LogP of 1-naphthoyl isocyanate is 2.31580. |
| Q: What is the molecular weight of 1-naphthoyl isocyanate? |
| A: Molecular weight of 1-naphthoyl isocyanate is 197.18900. |