Benzenesulfonic acid,4-nitro-, 2-(1-phenylethylidene)hydrazide structure
|
Common Name | Benzenesulfonic acid,4-nitro-, 2-(1-phenylethylidene)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 6949-53-7 | Molecular Weight | 319.33600 | |
| Density | 1.35g/cm3 | Boiling Point | 499.6ºC at 760mmHg | |
| Molecular Formula | C14H13N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256ºC | |
| Name | 4-nitro-N-[(Z)-1-phenylethylideneamino]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 499.6ºC at 760mmHg |
| Molecular Formula | C14H13N3O4S |
| Molecular Weight | 319.33600 |
| Flash Point | 256ºC |
| Exact Mass | 319.06300 |
| PSA | 112.73000 |
| LogP | 4.29220 |
| Index of Refraction | 1.626 |
| InChIKey | YQHJKTDOOMHTFB-PTNGSMBKSA-N |
| SMILES | CC(=NNS(=O)(=O)c1ccc([N+](=O)[O-])cc1)c1ccccc1 |
|
~71%
Benzenesulfonic... CAS#:6949-53-7 |
| Literature: Yamashita, Mitsuji; Takeuchi, Jun; Nakatani, Kaname; Oshikawa, Tatsuo; Inokawa, Saburo Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 1 p. 377 - 378 |
|
~%
Benzenesulfonic... CAS#:6949-53-7 |
| Literature: Yamashita, Mitsuji; Takeuchi, Jun; Nakatani, Kaname; Oshikawa, Tatsuo; Inokawa, Saburo Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 1 p. 377 - 378 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Acetophenone p-nitrophenylsulfonylhydrazone |