ethyl 2-(2-cyclohexylethyl)-3-oxo-butanoate structure
|
Common Name | ethyl 2-(2-cyclohexylethyl)-3-oxo-butanoate | ||
|---|---|---|---|---|
| CAS Number | 6949-93-5 | Molecular Weight | 240.33900 | |
| Density | 0.984g/cm3 | Boiling Point | 320.3ºC at 760 mmHg | |
| Molecular Formula | C14H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.2ºC | |
| Name | Oxyphenon |
|---|---|
| Synonym | More Synonyms |
| Density | 0.984g/cm3 |
|---|---|
| Boiling Point | 320.3ºC at 760 mmHg |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.33900 |
| Flash Point | 136.2ºC |
| Exact Mass | 240.17300 |
| PSA | 43.37000 |
| LogP | 3.11520 |
| Index of Refraction | 1.457 |
| InChIKey | KXHGOJZCEBYJTR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CCC1CCCCC1)C(C)=O |
|
~%
ethyl 2-(2-cycl... CAS#:6949-93-5 |
| Literature: Vaughan; Andersen Journal of the American Chemical Society, 1955 , vol. 77, p. 6702 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| Subranyl |
| Antrenyl bromide |
| ANTRENYL |
| Oxifenon |
| OXYPHENONIUM BROMIDE |
| Spasmophen |
| oxyphenonium |
| Oxyfenon |