Hexadecanoic acid,9,10,16-trihydroxy structure
|
Common Name | Hexadecanoic acid,9,10,16-trihydroxy | ||
|---|---|---|---|---|
| CAS Number | 6949-98-0 | Molecular Weight | 304.42200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H32O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9,10,16-trihydroxyhexadecanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H32O5 |
|---|---|
| Molecular Weight | 304.42200 |
| Exact Mass | 304.22500 |
| PSA | 97.99000 |
| LogP | 2.46630 |
| InChIKey | MEHUJCGAYMDLEL-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCCCCC(O)C(O)CCCCCCO |
| HS Code | 2918199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Name: Primary high throughput screening by co-culture imaging for identification hits as a ...
Source: 23209
Target: N/A
External Id: UIHTS20180925
|
|
Name: The chemical genetic matrix (CGM) dataset as reported in Wildenhain et al. (2015) Pre...
Source: 11924
Target: N/A
External Id: CGM data for Cell Systems paper Dec 2015
|
| threo-aleuritic acid |
| aleuritolic acid |