2H-Cyclopenta[b]pyridin-2-one,4-amino-3-bromo-1,5,6,7-tetrahydro- structure
|
Common Name | 2H-Cyclopenta[b]pyridin-2-one,4-amino-3-bromo-1,5,6,7-tetrahydro- | ||
|---|---|---|---|---|
| CAS Number | 6950-48-7 | Molecular Weight | 229.07400 | |
| Density | 1.73g/cm3 | Boiling Point | 390.8ºC at 760mmHg | |
| Molecular Formula | C8H9BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.2ºC | |
| Name | 4-amino-3-bromo-1,5,6,7-tetrahydrocyclopenta[b]pyridin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.73g/cm3 |
|---|---|
| Boiling Point | 390.8ºC at 760mmHg |
| Molecular Formula | C8H9BrN2O |
| Molecular Weight | 229.07400 |
| Flash Point | 190.2ºC |
| Exact Mass | 227.99000 |
| PSA | 58.88000 |
| LogP | 1.78950 |
| Index of Refraction | 1.666 |
| InChIKey | TUTGUALTIUSEJO-UHFFFAOYSA-N |
| SMILES | Nc1c2c([nH]c(=O)c1Br)CCC2 |
|
~%
2H-Cyclopenta[b... CAS#:6950-48-7 |
| Literature: Schroeder; Rigby Journal of the American Chemical Society, 1949 , vol. 71, p. 2205,2207 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-amino-3-bromo-6,7-dihydro-5H-[1]pyrindin-2-ol |
| 4-amino-3-bromo-1,5,6,7-tetrahydro-2h-cyclopenta[b]pyridin-2-one |
| 4-Amino-3-brom-6,7-dihydro-5H-[1]pyrindin-2-ol |