Acetic acid,2-[[(4-methoxyphenyl)methyl]nitrosoamino]- structure
|
Common Name | Acetic acid,2-[[(4-methoxyphenyl)methyl]nitrosoamino]- | ||
|---|---|---|---|---|
| CAS Number | 6951-21-9 | Molecular Weight | 224.21300 | |
| Density | 1.25g/cm3 | Boiling Point | 477.4ºC at 760 mmHg | |
| Molecular Formula | C10H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.5ºC | |
| Name | 2-[(4-methoxyphenyl)methyl-nitrosoamino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 477.4ºC at 760 mmHg |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.21300 |
| Flash Point | 242.5ºC |
| Exact Mass | 224.08000 |
| PSA | 79.20000 |
| LogP | 1.26320 |
| Index of Refraction | 1.551 |
| InChIKey | GVWIHULDOAOZQB-UHFFFAOYSA-N |
| SMILES | COc1ccc(CN(CC(=O)O)N=O)cc1 |
| HS Code | 2922509090 |
|---|
|
~%
Acetic acid,2-[... CAS#:6951-21-9 |
| Literature: Greco,C.V. et al. Journal of Medicinal and Pharmaceutical Chemistry, 1962 , vol. 5, p. 861 - 865 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(4-methoxy-benzyl)-N-nitroso-glycine |
| [(4-methoxybenzyl)(nitroso)amino]acetic acid |
| N-Nitroso-N-(4-methoxy-benzyl)-glycin |