2-(5-decyl-2-ethynylphenyl)ethynyl-tri(propan-2-yl)silane structure
|
Common Name | 2-(5-decyl-2-ethynylphenyl)ethynyl-tri(propan-2-yl)silane | ||
|---|---|---|---|---|
| CAS Number | 695161-59-2 | Molecular Weight | 422.76100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H46Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(5-decyl-2-ethynylphenyl)ethynyl-tri(propan-2-yl)silane |
|---|
| Molecular Formula | C29H46Si |
|---|---|
| Molecular Weight | 422.76100 |
| Exact Mass | 422.33700 |
| LogP | 8.92060 |
| InChIKey | WVPPQUKINVDDBY-UHFFFAOYSA-N |
| SMILES | C#Cc1ccc(CCCCCCCCCC)cc1C#C[Si](C(C)C)(C(C)C)C(C)C |
|
~%
2-(5-decyl-2-et... CAS#:695161-59-2 |
| Literature: Marsden, Jeremiah A.; Miller, Jeremie J.; Shirtcliff, Laura D.; Haley, Michael M. Journal of the American Chemical Society, 2005 , vol. 127, # 8 p. 2464 - 2476 |