Propanedioic acid,2-(acetylamino)-2-[(5-amino-1H-indol-3-yl)methyl]-, 1,3-diethyl ester structure
|
Common Name | Propanedioic acid,2-(acetylamino)-2-[(5-amino-1H-indol-3-yl)methyl]-, 1,3-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 6952-16-5 | Molecular Weight | 361.39200 | |
| Density | 1.281g/cm3 | Boiling Point | 608.3ºC at 760mmHg | |
| Molecular Formula | C18H23N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 321.7ºC | |
| Name | diethyl 2-acetamido-2-[(5-amino-1H-indol-3-yl)methyl]propanedioate |
|---|
| Density | 1.281g/cm3 |
|---|---|
| Boiling Point | 608.3ºC at 760mmHg |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.39200 |
| Flash Point | 321.7ºC |
| Exact Mass | 361.16400 |
| PSA | 123.51000 |
| LogP | 2.26580 |
| Index of Refraction | 1.6 |
| InChIKey | LMIVCDUFWCNZDD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1c[nH]c2ccc(N)cc12)(NC(C)=O)C(=O)OCC |
|
~%
Propanedioic ac... CAS#:6952-16-5 |
| Literature: Settimj; Del Giudice; Ferretti; Gatta Journal of Heterocyclic Chemistry, 1988 , vol. 25, # 5 p. 1391 - 1397 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |