Phenanthrene, 9,10-dihydro-2,7-dinitro structure
|
Common Name | Phenanthrene, 9,10-dihydro-2,7-dinitro | ||
|---|---|---|---|---|
| CAS Number | 69533-68-2 | Molecular Weight | 270.24000 | |
| Density | 1.424g/cm3 | Boiling Point | 457.8ºC at 760 mmHg | |
| Molecular Formula | C14H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228ºC | |
| Name | 2,7-dinitro-9,10-dihydrophenanthrene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.424g/cm3 |
|---|---|
| Boiling Point | 457.8ºC at 760 mmHg |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24000 |
| Flash Point | 228ºC |
| Exact Mass | 270.06400 |
| PSA | 91.64000 |
| LogP | 4.31500 |
| Index of Refraction | 1.677 |
| InChIKey | ITOVIJSDNGFFNC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CCc1cc([N+](=O)[O-])ccc1-2 |
|
~46%
Phenanthrene, 9... CAS#:69533-68-2 |
| Literature: Nelsen, Stephen F.; Luo, Yun; Weaver, Michael N.; Lockard, Jenny V.; Zink, Jeffrey I. Journal of Organic Chemistry, 2006 , vol. 71, # 11 p. 4286 - 4295 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 9,10-Dihydro-2,7-dinitrophenanthrene |
| Phenanthrene,9,10-dihydro-2,7-dinitro |
| 2,7-Dinitro-9-10-dihydrophenanthrene |