1-Phenyl-4-isonicotinoylthiosemicarbazide structure
|
Common Name | 1-Phenyl-4-isonicotinoylthiosemicarbazide | ||
|---|---|---|---|---|
| CAS Number | 6954-50-3 | Molecular Weight | 272.32600 | |
| Density | 1.357g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H12N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(anilinocarbamothioyl)pyridine-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.357g/cm3 |
|---|---|
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.32600 |
| Exact Mass | 272.07300 |
| PSA | 98.14000 |
| LogP | 2.56780 |
| Index of Refraction | 1.705 |
| InChIKey | GDEQICJHJBGISZ-UHFFFAOYSA-N |
| SMILES | O=C(NNC(=S)Nc1ccccc1)c1ccncc1 |
| HS Code | 2933399090 |
|---|
|
~95%
1-Phenyl-4-ison... CAS#:6954-50-3 |
| Literature: Cardia, Maria Cristina; Distinto, Simona; Maccioni, Elias; Plumitallo, Antonio; Saddi, Manuela; Sanna, Maria Luisa; DeLogu, Alessandro Journal of Heterocyclic Chemistry, 2006 , vol. 43, # 5 p. 1337 - 1342 |
|
~%
1-Phenyl-4-ison... CAS#:6954-50-3 |
| Literature: Maghari, Shokoofeh; Ramezanpour, Sorour; Darvish, Fatemeh; Balalaie, Saeed; Rominger, Frank; Bijanzadeh, Hamid Reza Tetrahedron, 2013 , vol. 69, # 8 p. 2075 - 2080 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-isonicotinyl-N'-phenylthiosemicarbazide |
| 1-isonicotinoyl-4-phenylthiosemicarbazide |
| 1-Phenyl-4-isonicotinoylthiosemicarbazide |
| 2-isonicotinoyl-N-phenylhydrazinecarbothioamide |