2,5-dimethyl-4-nitro-benzoic acid structure
|
Common Name | 2,5-dimethyl-4-nitro-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 6954-70-7 | Molecular Weight | 195.17200 | |
| Density | 1.333g/cm3 | Boiling Point | 367.2ºC at 760 mmHg | |
| Molecular Formula | C9H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163ºC | |
| Name | 2,5-dimethyl-4-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.333g/cm3 |
|---|---|
| Boiling Point | 367.2ºC at 760 mmHg |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17200 |
| Flash Point | 163ºC |
| Exact Mass | 195.05300 |
| PSA | 83.12000 |
| LogP | 2.43300 |
| Index of Refraction | 1.589 |
| InChIKey | WQJLIVQRJOLTMH-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])c(C)cc1C(=O)O |
| HS Code | 2916399090 |
|---|
|
~%
2,5-dimethyl-4-... CAS#:6954-70-7 |
| Literature: Fisher; Walling Journal of the American Chemical Society, 1935 , vol. 57, p. 1700 |
|
~%
2,5-dimethyl-4-... CAS#:6954-70-7 |
| Literature: Fisher; Walling Journal of the American Chemical Society, 1935 , vol. 57, p. 1700 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,5-Dimethyl-4-nitro-benzoesaeure |
| 2,5-dimethyl-4-nitro-benzoic acid |