2-benzoyl-6-methoxy-1-benzofuran-3-one structure
|
Common Name | 2-benzoyl-6-methoxy-1-benzofuran-3-one | ||
|---|---|---|---|---|
| CAS Number | 69545-21-7 | Molecular Weight | 268.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-benzoyl-6-methoxy-1-benzofuran-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12O4 |
|---|---|
| Molecular Weight | 268.26400 |
| Exact Mass | 268.07400 |
| PSA | 52.60000 |
| LogP | 2.52180 |
| InChIKey | ZJZROSOSYYBYHU-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)OC(C(=O)c1ccccc1)C2=O |
|
~%
2-benzoyl-6-met... CAS#:69545-21-7 |
| Literature: Prakash; Goyal Synthesis, 1992 , # 7 p. 629 - 630 |
|
~%
2-benzoyl-6-met... CAS#:69545-21-7 |
| Literature: Prakash; Goyal Synthesis, 1992 , # 7 p. 629 - 630 |
|
~%
2-benzoyl-6-met... CAS#:69545-21-7 |
| Literature: Brady, Brian A.; Geoghegan, Michael; McMurtey, Kenneth D.; O'Sullian, Ivo W. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 119 - 123 |
| 6-methoxy-2-benzoylcoumaran-3-one |
| 2-Benzoyl-6-methoxy-cumaran-3-on |