pentyl 4-propan-2-ylbenzoate structure
|
Common Name | pentyl 4-propan-2-ylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 6955-07-3 | Molecular Weight | 234.33400 | |
| Density | 0.962g/cm3 | Boiling Point | 315.9ºC at 760 mmHg | |
| Molecular Formula | C15H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.1ºC | |
| Name | pentyl 4-propan-2-ylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.962g/cm3 |
|---|---|
| Boiling Point | 315.9ºC at 760 mmHg |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.33400 |
| Flash Point | 141.1ºC |
| Exact Mass | 234.16200 |
| PSA | 26.30000 |
| LogP | 4.15700 |
| Index of Refraction | 1.492 |
| InChIKey | LHPAFLZJGLAMFD-UHFFFAOYSA-N |
| SMILES | CCCCCOC(=O)c1ccc(C(C)C)cc1 |
|
~%
pentyl 4-propan... CAS#:6955-07-3 |
| Literature: Carkhuff; Gramling Journal of the American Pharmaceutical Association (1912-1977), 1949 , vol. 38, p. 555 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-isopropyl-benzoic acid pentyl ester |
| 4-Isopropyl-benzoesaeure-pentylester |