[1,1'-Biphenyl]-2-carboxylicacid, 2'-[(diethylamino)carbonyl]- structure
|
Common Name | [1,1'-Biphenyl]-2-carboxylicacid, 2'-[(diethylamino)carbonyl]- | ||
|---|---|---|---|---|
| CAS Number | 6955-22-2 | Molecular Weight | 297.34800 | |
| Density | 1.163g/cm3 | Boiling Point | 491.6ºC at 760 mmHg | |
| Molecular Formula | C18H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.1ºC | |
| Name | 2-[2-(diethylcarbamoyl)phenyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.163g/cm3 |
|---|---|
| Boiling Point | 491.6ºC at 760 mmHg |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.34800 |
| Flash Point | 251.1ºC |
| Exact Mass | 297.13600 |
| PSA | 57.61000 |
| LogP | 3.53380 |
| Index of Refraction | 1.583 |
| InChIKey | GLEINWWQSCYMIV-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)c1ccccc1-c1ccccc1C(=O)O |
|
~%
[1,1'-Biphenyl]... CAS#:6955-22-2 |
| Literature: Boyd,G.V.; Monteil,R.L. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1978 , p. 1338 - 1350 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N.N-Diethyldiphenamic saeure |
| Diphensaeure-diaethylamid |
| N.N-Diaethyl-diphenamidsaeure |
| CCG-5722 |
| HMS1654G19 |
| N,N-Diethyl-2,2'-diphenamidsaeure |