Acetamide,N-(3-chloro-9-hydroxy-9H-fluoren-2-yl)-
Modify Date: 2025-10-24 19:14:03
Acetamide,N-(3-chloro-9-hydroxy-9H-fluoren-2-yl)- structure
|
Common Name | Acetamide,N-(3-chloro-9-hydroxy-9H-fluoren-2-yl)- | ||
|---|---|---|---|---|
| CAS Number | 6955-66-4 | Molecular Weight | 273.71400 | |
| Density | 1.437g/cm3 | Boiling Point | 530.5ºC at 760mmHg | |
| Molecular Formula | C15H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.6ºC | |
| Name | N-(3-chloro-9-hydroxy-9H-fluoren-2-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.437g/cm3 |
|---|---|
| Boiling Point | 530.5ºC at 760mmHg |
| Molecular Formula | C15H12ClNO2 |
| Molecular Weight | 273.71400 |
| Flash Point | 274.6ºC |
| Exact Mass | 273.05600 |
| PSA | 49.33000 |
| LogP | 3.43350 |
| Index of Refraction | 1.712 |
| InChIKey | CASGYINMONDDLS-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc2c(cc1Cl)-c1ccccc1C2O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| hms3085p03 |