Acetamide,N-[1,4-dihydro-1,4-dioxo-3-(2-propen-1-ylamino)-2-naphthalenyl]- structure
|
Common Name | Acetamide,N-[1,4-dihydro-1,4-dioxo-3-(2-propen-1-ylamino)-2-naphthalenyl]- | ||
|---|---|---|---|---|
| CAS Number | 6957-01-3 | Molecular Weight | 270.28300 | |
| Density | 1.26g/cm3 | Boiling Point | 469ºC at 760 mmHg | |
| Molecular Formula | C15H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.6ºC | |
| Name | N-[1,4-dioxo-3-(prop-2-enylamino)naphthalen-2-yl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 469ºC at 760 mmHg |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.28300 |
| Flash Point | 183.6ºC |
| Exact Mass | 270.10000 |
| PSA | 75.27000 |
| LogP | 1.97070 |
| Index of Refraction | 1.602 |
| InChIKey | PNGZAXIAGZXAOI-UHFFFAOYSA-N |
| SMILES | C=CCNC1=C(NC(C)=O)C(=O)c2ccccc2C1=O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| n-[1,4-dioxo-3-(prop-2-en-1-ylamino)-1,4-dihydronaphthalen-2-yl]acetamide |