1H-Phenalen-1-ylium, 1,3-dihydroxy
Modify Date: 2026-07-11 11:34:59
1H-Phenalen-1-ylium, 1,3-dihydroxy structure
|
Common Name | 1H-Phenalen-1-ylium, 1,3-dihydroxy | ||
|---|---|---|---|---|
| CAS Number | 69578-14-9 | Molecular Weight | 197.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9O2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1H-Phenalen-1-ylium, 1,3-dihydroxy |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H9O2+ |
|---|---|
| Molecular Weight | 197.21 |
| InChIKey | DXBYIIARRIMNFJ-UHFFFAOYSA-O |
| SMILES | OC1=CC(=[OH+])c2cccc3cccc1c23 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 69578-14-9? |
| A: Chinese name of 69578-14-9 is 69578-14-9. |
| Q: What is the molecular weight of 1H-Phenalen-1-ylium, 1,3-dihydroxy? |
| A: Molecular weight of 1H-Phenalen-1-ylium, 1,3-dihydroxy is 197.21. |
| Q: What is the SMILES notation of 1H-Phenalen-1-ylium, 1,3-dihydroxy? |
| A: SMILES notation of 1H-Phenalen-1-ylium, 1,3-dihydroxy is OC1=CC(=[OH+])c2cccc3cccc1c23. |
| Q: What is the InChIKey of 1H-Phenalen-1-ylium, 1,3-dihydroxy? |
| A: InChIKey of 1H-Phenalen-1-ylium, 1,3-dihydroxy is DXBYIIARRIMNFJ-UHFFFAOYSA-O. |
| Q: What is the molecular formula of 1H-Phenalen-1-ylium, 1,3-dihydroxy? |
| A: Molecular formula of 1H-Phenalen-1-ylium, 1,3-dihydroxy is C13H9O2+. |
| Q: What is the English name of 1H-Phenalen-1-ylium, 1,3-dihydroxy? |
| A: The English name of 1H-Phenalen-1-ylium, 1,3-dihydroxy is 1H-Phenalen-1-ylium, 1,3-dihydroxy. |
| Q: What is the CAS number of 1H-Phenalen-1-ylium, 1,3-dihydroxy? |
| A: CAS number of 1H-Phenalen-1-ylium, 1,3-dihydroxy is 69578-14-9. |