N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine
Modify Date: 2025-12-12 20:43:30
![N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine Structure](https://image.chemsrc.com/caspic/354/69578-68-3.png)
N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine structure
|
Common Name | N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine | ||
|---|---|---|---|---|
| CAS Number | 69578-68-3 | Molecular Weight | 244.33500 | |
| Density | 1.22g/cm3 | Boiling Point | 392.6ºC at 760 mmHg | |
| Molecular Formula | C14H20N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.2ºC | |
| Name | N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 392.6ºC at 760 mmHg |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.33500 |
| Flash Point | 191.2ºC |
| Exact Mass | 244.16900 |
| PSA | 50.17000 |
| LogP | 3.16370 |
| Index of Refraction | 1.643 |
| InChIKey | AFOHMMDPNJDFGN-UHFFFAOYSA-N |
| SMILES | CC12CCC(CC1=NNc1cccnn1)C2(C)C |
|
~61%
N-[(4,7,7-trime... CAS#:69578-68-3 |
| Literature: Szilagyi; Kasztreiner; Matyus; et al. European Journal of Medicinal Chemistry, 1984 , vol. 19, # 2 p. 111 - 117 |
![1,7,7-trimethyl-bicyclo[2.2.1]heptane-2-one structure](https://image.chemsrc.com/caspic/166/736109-58-3.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| bornan-2-one pyridazin-3-ylhydrazone |