N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine
![N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine Structure](https://image.chemsrc.com/caspic/354/69578-68-3.png)
N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine structure
|
Common Name | N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine | ||
|---|---|---|---|---|
| CAS Number | 69578-68-3 | Molecular Weight | 244.33500 | |
| Density | 1.22g/cm3 | Boiling Point | 392.6ºC at 760 mmHg | |
| Molecular Formula | C14H20N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 392.6ºC at 760 mmHg |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.33500 |
| Flash Point | 191.2ºC |
| Exact Mass | 244.16900 |
| PSA | 50.17000 |
| LogP | 3.16370 |
| Index of Refraction | 1.643 |
| InChIKey | AFOHMMDPNJDFGN-UHFFFAOYSA-N |
| SMILES | CC12CCC(CC1=NNc1cccnn1)C2(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~61%
N-[(4,7,7-trime... CAS#:69578-68-3 |
| Literature: Szilagyi; Kasztreiner; Matyus; et al. European Journal of Medicinal Chemistry, 1984 , vol. 19, # 2 p. 111 - 117 |
![1,7,7-trimethyl-bicyclo[2.2.1]heptane-2-one structure](https://image.chemsrc.com/caspic/166/736109-58-3.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| bornan-2-one pyridazin-3-ylhydrazone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine? |
| A: Boiling point of N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine is 392.6ºC at 760 mmHg. |
| Q: What is the LogP of N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine? |
| A: LogP of N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine is 3.16370. |
| Q: What are the upstream materials of N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine? |
| A: Related upstream materials(CAS) of N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine: 40972-16-5;736109-58-3. |
| Q: What is the molecular weight of N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine? |
| A: Molecular weight of N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine is 244.33500. |
| Q: What is the polar surface area (PSA) of N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine? |
| A: Polar surface area (PSA) of N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine is 50.17000. |
| Q: What is the SMILES notation of N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine? |
| A: SMILES notation of N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine is CC12CCC(CC1=NNc1cccnn1)C2(C)C. |
| Q: What English synonyms does N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine have? |
| A: English synonyms of N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine: bornan-2-one pyridazin-3-ylhydrazone. |
| Q: What is the molecular formula of N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine? |
| A: Molecular formula of N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine is C14H20N4. |
| Q: What is the CAS number of N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine? |
| A: CAS number of N-[(4,7,7-trimethyl-3-bicyclo[2.2.1]heptanylidene)amino]pyridazin-3-amine is 69578-68-3. |
| Q: What is the Chinese name of 69578-68-3? |
| A: Chinese name of 69578-68-3 is 69578-68-3. |