N-(cyclohexylideneamino)-6-morpholin-4-ylpyridazin-3-amine structure
|
Common Name | N-(cyclohexylideneamino)-6-morpholin-4-ylpyridazin-3-amine | ||
|---|---|---|---|---|
| CAS Number | 69578-74-1 | Molecular Weight | 275.34900 | |
| Density | 1.31g/cm3 | Boiling Point | 517.4ºC at 760 mmHg | |
| Molecular Formula | C14H21N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.7ºC | |
| Name | N-(cyclohexylideneamino)-6-morpholin-4-ylpyridazin-3-amine |
|---|
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 517.4ºC at 760 mmHg |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.34900 |
| Flash Point | 266.7ºC |
| Exact Mass | 275.17500 |
| PSA | 65.87000 |
| LogP | 1.53210 |
| Index of Refraction | 1.659 |
| InChIKey | JCEBXSUFUCRSGW-UHFFFAOYSA-N |
| SMILES | c1cc(N2CCOCC2)nnc1NN=C1CCCCC1 |
|
~51%
N-(cyclohexylid... CAS#:69578-74-1 |
| Literature: Szilagyi; Kasztreiner; Matyus; et al. European Journal of Medicinal Chemistry, 1984 , vol. 19, # 2 p. 111 - 117 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |