propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate
![propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate Structure](https://image.chemsrc.com/caspic/037/69578-90-1.png)
propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate structure
|
Common Name | propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate | ||
|---|---|---|---|---|
| CAS Number | 69578-90-1 | Molecular Weight | 270.71500 | |
| Density | 1.28g/cm3 | Boiling Point | 427.1ºC at 760mmHg | |
| Molecular Formula | C11H15ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 427.1ºC at 760mmHg |
| Molecular Formula | C11H15ClN4O2 |
| Molecular Weight | 270.71500 |
| Flash Point | 212.1ºC |
| Exact Mass | 270.08800 |
| PSA | 79.70000 |
| LogP | 1.68300 |
| Index of Refraction | 1.57 |
| InChIKey | VLQIETABXVBYDB-MDWZMJQESA-N |
| SMILES | CCCOC(=O)CC(C)=NNc1ccc(Cl)nn1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
propyl (3E)-3-[... CAS#:69578-90-1 |
| Literature: Szilagyi; Kasztreiner; Matyus; et al. European Journal of Medicinal Chemistry, 1984 , vol. 19, # 2 p. 111 - 117 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate? |
| A: Molecular weight of propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate is 270.71500. |
| Q: What is the SMILES notation of propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate? |
| A: SMILES notation of propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate is CCCOC(=O)CC(C)=NNc1ccc(Cl)nn1. |
| Q: What is the English name of propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate? |
| A: The English name of propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate is propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate. |
| Q: What is the LogP of propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate? |
| A: LogP of propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate is 1.68300. |
| Q: What are the upstream materials of propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate? |
| A: Related upstream materials(CAS) of propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate: 17284-97-8;1779-60-8. |
| Q: What is the polar surface area (PSA) of propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate? |
| A: Polar surface area (PSA) of propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate is 79.70000. |
| Q: What is the Chinese name of 69578-90-1? |
| A: Chinese name of 69578-90-1 is 69578-90-1. |
| Q: What is the molecular formula of propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate? |
| A: Molecular formula of propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate is C11H15ClN4O2. |
| Q: What is the InChIKey of propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate? |
| A: InChIKey of propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate is VLQIETABXVBYDB-MDWZMJQESA-N. |
| Q: What is the CAS number of propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate? |
| A: CAS number of propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate is 69578-90-1. |