octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate
Modify Date: 2025-08-26 08:26:08
![octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate Structure](https://image.chemsrc.com/caspic/423/69578-93-4.png)
octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate structure
|
Common Name | octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate | ||
|---|---|---|---|---|
| CAS Number | 69578-93-4 | Molecular Weight | 340.84800 | |
| Density | 1.16g/cm3 | Boiling Point | 482.3ºC at 760mmHg | |
| Molecular Formula | C16H25ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.5ºC | |
| Name | octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate |
|---|
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 482.3ºC at 760mmHg |
| Molecular Formula | C16H25ClN4O2 |
| Molecular Weight | 340.84800 |
| Flash Point | 245.5ºC |
| Exact Mass | 340.16700 |
| PSA | 79.70000 |
| LogP | 3.63350 |
| Index of Refraction | 1.546 |
| InChIKey | HPGBRSGGQCAFBZ-QGOAFFKASA-N |
| SMILES | CCCCCCCCOC(=O)CC(C)=NNc1ccc(Cl)nn1 |
|
~57%
octyl (3E)-3-[(... CAS#:69578-93-4 |
| Literature: Szilagyi; Kasztreiner; Matyus; et al. European Journal of Medicinal Chemistry, 1984 , vol. 19, # 2 p. 111 - 117 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |