octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate
![octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate Structure](https://image.chemsrc.com/caspic/423/69578-93-4.png)
octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate structure
|
Common Name | octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate | ||
|---|---|---|---|---|
| CAS Number | 69578-93-4 | Molecular Weight | 340.84800 | |
| Density | 1.16g/cm3 | Boiling Point | 482.3ºC at 760mmHg | |
| Molecular Formula | C16H25ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 482.3ºC at 760mmHg |
| Molecular Formula | C16H25ClN4O2 |
| Molecular Weight | 340.84800 |
| Flash Point | 245.5ºC |
| Exact Mass | 340.16700 |
| PSA | 79.70000 |
| LogP | 3.63350 |
| Index of Refraction | 1.546 |
| InChIKey | HPGBRSGGQCAFBZ-QGOAFFKASA-N |
| SMILES | CCCCCCCCOC(=O)CC(C)=NNc1ccc(Cl)nn1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~57%
octyl (3E)-3-[(... CAS#:69578-93-4 |
| Literature: Szilagyi; Kasztreiner; Matyus; et al. European Journal of Medicinal Chemistry, 1984 , vol. 19, # 2 p. 111 - 117 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate? |
| A: Related upstream materials(CAS) of octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate: 17284-97-8;16436-00-3. |
| Q: What is the SMILES notation of octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate? |
| A: SMILES notation of octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate is CCCCCCCCOC(=O)CC(C)=NNc1ccc(Cl)nn1. |
| Q: What is the polar surface area (PSA) of octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate? |
| A: Polar surface area (PSA) of octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate is 79.70000. |
| Q: What is the English name of octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate? |
| A: The English name of octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate is octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate. |
| Q: What is the molecular weight of octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate? |
| A: Molecular weight of octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate is 340.84800. |
| Q: What is the molecular formula of octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate? |
| A: Molecular formula of octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate is C16H25ClN4O2. |
| Q: What is the InChIKey of octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate? |
| A: InChIKey of octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate is HPGBRSGGQCAFBZ-QGOAFFKASA-N. |
| Q: What is the LogP of octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate? |
| A: LogP of octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate is 3.63350. |
| Q: What is the CAS number of octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate? |
| A: CAS number of octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate is 69578-93-4. |
| Q: What is the boiling point of octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate? |
| A: Boiling point of octyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate is 482.3ºC at 760mmHg. |