tert-butyl (4E)-4-[(6-chloropyridazin-3-yl)hydrazinylidene]pentanoate structure
|
Common Name | tert-butyl (4E)-4-[(6-chloropyridazin-3-yl)hydrazinylidene]pentanoate | ||
|---|---|---|---|---|
| CAS Number | 69579-05-1 | Molecular Weight | 298.76900 | |
| Density | 1.208g/cm3 | Boiling Point | 444.776ºC at 760 mmHg | |
| Molecular Formula | C13H19ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.793ºC | |
| Name | tert-butyl (4E)-4-[(6-chloropyridazin-3-yl)hydrazinylidene]pentanoate |
|---|
| Density | 1.208g/cm3 |
|---|---|
| Boiling Point | 444.776ºC at 760 mmHg |
| Molecular Formula | C13H19ClN4O2 |
| Molecular Weight | 298.76900 |
| Flash Point | 222.793ºC |
| Exact Mass | 298.12000 |
| PSA | 79.70000 |
| LogP | 2.46160 |
| Index of Refraction | 1.55 |
| InChIKey | HGEHKLOUMMOGOO-OQLLNIDSSA-N |
| SMILES | CC(CCC(=O)OC(C)(C)C)=NNc1ccc(Cl)nn1 |
|
~76%
tert-butyl (4E)... CAS#:69579-05-1 |
| Literature: Szilagyi; Kasztreiner; Matyus; et al. European Journal of Medicinal Chemistry, 1984 , vol. 19, # 2 p. 111 - 117 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |