ethyl (3E)-3-[(6-oxo-1H-pyridazin-3-yl)hydrazinylidene]butanoate structure
|
Common Name | ethyl (3E)-3-[(6-oxo-1H-pyridazin-3-yl)hydrazinylidene]butanoate | ||
|---|---|---|---|---|
| CAS Number | 69579-15-3 | Molecular Weight | 238.24300 | |
| Density | 1.29g/cm3 | Boiling Point | 453.2ºC at 760mmHg | |
| Molecular Formula | C10H14N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.9ºC | |
| Name | ethyl (3E)-3-[(6-oxo-1H-pyridazin-3-yl)hydrazinylidene]butanoate |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 453.2ºC at 760mmHg |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.24300 |
| Flash Point | 227.9ºC |
| Exact Mass | 238.10700 |
| PSA | 99.93000 |
| LogP | 0.34510 |
| Index of Refraction | 1.58 |
| InChIKey | IIPJJAQCEJCNFC-YRNVUSSQSA-N |
| SMILES | CCOC(=O)CC(C)=NNc1ccc(=O)[nH]n1 |
|
~30%
ethyl (3E)-3-[(... CAS#:69579-15-3 |
| Literature: Szilagyi; Kasztreiner; Matyus; et al. European Journal of Medicinal Chemistry, 1984 , vol. 19, # 2 p. 111 - 117 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |