(3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanamide
Modify Date: 2025-08-25 16:44:43
![(3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanamide Structure](https://image.chemsrc.com/caspic/384/69579-27-7.png)
(3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanamide structure
|
Common Name | (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanamide | ||
|---|---|---|---|---|
| CAS Number | 69579-27-7 | Molecular Weight | 227.65100 | |
| Density | 1.47g/cm3 | Boiling Point | 499.4ºC at 760mmHg | |
| Molecular Formula | C8H10ClN5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.8ºC | |
| Name | (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanamide |
|---|
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 499.4ºC at 760mmHg |
| Molecular Formula | C8H10ClN5O |
| Molecular Weight | 227.65100 |
| Flash Point | 255.8ºC |
| Exact Mass | 227.05700 |
| PSA | 97.48000 |
| LogP | 1.36480 |
| Index of Refraction | 1.65 |
| InChIKey | BMMOORAJRAFRTF-VZUCSPMQSA-N |
| SMILES | CC(CC(N)=O)=NNc1ccc(Cl)nn1 |
|
~43%
(3E)-3-[(6-chlo... CAS#:69579-27-7 |
| Literature: Szilagyi; Kasztreiner; Matyus; et al. European Journal of Medicinal Chemistry, 1984 , vol. 19, # 2 p. 111 - 117 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |