Benzoic acid,4-[(2-carboxyethyl)amino]-, 1-ethyl ester structure
|
Common Name | Benzoic acid,4-[(2-carboxyethyl)amino]-, 1-ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 6959-76-8 | Molecular Weight | 237.25200 | |
| Density | 1.242g/cm3 | Boiling Point | 443.4ºC at 760 mmHg | |
| Molecular Formula | C12H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.9ºC | |
| Name | Benzoic acid,4-[(2-carboxyethyl)amino]-, 1-ethyl ester |
|---|
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 443.4ºC at 760 mmHg |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25200 |
| Flash Point | 221.9ºC |
| Exact Mass | 237.10000 |
| PSA | 75.63000 |
| LogP | 1.82290 |
| Index of Refraction | 1.575 |
| InChIKey | BRZXYYOOKCQWKQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(NCCC(=O)O)cc1 |
|
~%
Benzoic acid,4-... CAS#:6959-76-8 |
| Literature: Hurd; Hayao Journal of the American Chemical Society, 1952 , vol. 74, p. 5889,5891 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |