Arsanilic acid,N-(dicarbamoylmethyl)- (8CI) structure
|
Common Name | Arsanilic acid,N-(dicarbamoylmethyl)- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 6961-38-2 | Molecular Weight | 317.13000 | |
| Density | N/A | Boiling Point | 798.1ºC at 760 mmHg | |
| Molecular Formula | C9H12AsN3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 436.5ºC | |
| Name | [4-(dicarbamoylmethyl-amino)-phenyl]-arsonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 798.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C9H12AsN3O5 |
| Molecular Weight | 317.13000 |
| Flash Point | 436.5ºC |
| Exact Mass | 316.99900 |
| PSA | 155.74000 |
| InChIKey | VSKPAWDJXIECDP-UHFFFAOYSA-N |
| SMILES | NC(=O)C(Nc1ccc([As](=O)(O)O)cc1)C(N)=O |
|
~%
Arsanilic acid,... CAS#:6961-38-2 |
| Literature: Lewis; Bent Journal of the American Chemical Society, 1926 , vol. 48, p. 956 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Arsono-anilinomalonsaeure-diamid |
| 4-butylsulfanyl-benzonitrile |
| 4-Butylmercapto-benzonitril |
| 4-Butylmercapto-benzoesaeure-nitril |