Ethanone, 2-(6-methyl-1-oxido-2-pyridinyl)-1-phenyl- structure
|
Common Name | Ethanone, 2-(6-methyl-1-oxido-2-pyridinyl)-1-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 6961-55-3 | Molecular Weight | 227.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(6-methyl-1-oxidopyridin-1-ium-2-yl)-1-phenylethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13NO2 |
|---|---|
| Molecular Weight | 227.25900 |
| Exact Mass | 227.09500 |
| PSA | 42.53000 |
| LogP | 2.84890 |
| InChIKey | YQEPIDSBNXHJPH-UHFFFAOYSA-N |
| SMILES | Cc1cccc(CC(=O)c2ccccc2)[n+]1[O-] |
|
~%
Ethanone, 2-(6-... CAS#:6961-55-3 |
| Literature: Adams; Reifschneider Journal of the American Chemical Society, 1957 , vol. 79, p. 2236 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Methyl-6-phenacyl-pyridin-1-oxid |