Thiazolo[5,4-d]thiazole,2,5-bis(2,4-dimethoxyphenyl)- structure
|
Common Name | Thiazolo[5,4-d]thiazole,2,5-bis(2,4-dimethoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 6962-00-1 | Molecular Weight | 414.49800 | |
| Density | 1.313g/cm3 | Boiling Point | 603ºC at 760 mmHg | |
| Molecular Formula | C20H18N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 318.5ºC | |
| Name | 2,5-bis(2,4-dimethoxyphenyl)-[1,3]thiazolo[5,4-d][1,3]thiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.313g/cm3 |
|---|---|
| Boiling Point | 603ºC at 760 mmHg |
| Molecular Formula | C20H18N2O4S2 |
| Molecular Weight | 414.49800 |
| Flash Point | 318.5ºC |
| Exact Mass | 414.07100 |
| PSA | 119.18000 |
| LogP | 5.12120 |
| Index of Refraction | 1.634 |
| InChIKey | GUFPLICAYOTWJV-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nc3sc(-c4ccc(OC)cc4OC)nc3s2)c(OC)c1 |
|
~%
Thiazolo[5,4-d]... CAS#:6962-00-1 |
| Literature: Fikrat,H.T.; Oneto,J.F. Journal of Pharmaceutical Sciences, 1962 , vol. 51, p. 527 - 529 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2.5-Bis-<2.4-dimethoxy-phenyl>-thiazolo<5.4-d>thiazol |