Acetophenone, 2-[(2-hydroxypropyl)amino]-2-phenyl-,hydrochloride (8CI) structure
|
Common Name | Acetophenone, 2-[(2-hydroxypropyl)amino]-2-phenyl-,hydrochloride (8CI) | ||
|---|---|---|---|---|
| CAS Number | 6962-12-5 | Molecular Weight | 305.79900 | |
| Density | 1.128g/cm3 | Boiling Point | 445.1ºC at 760mmHg | |
| Molecular Formula | C17H20ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223ºC | |
| Name | 2-(2-hydroxypropylamino)-1,2-diphenylethanone,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.128g/cm3 |
|---|---|
| Boiling Point | 445.1ºC at 760mmHg |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.79900 |
| Flash Point | 223ºC |
| Exact Mass | 305.11800 |
| PSA | 49.33000 |
| LogP | 3.77390 |
| Index of Refraction | 1.583 |
| InChIKey | BSFZZNQJUBHLAG-UHFFFAOYSA-N |
| SMILES | CC(O)CNC(C(=O)c1ccccc1)c1ccccc1.Cl |
|
~%
Acetophenone, 2... CAS#:6962-12-5 |
| Literature: Lutz et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 2015,2022 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Cyclohepta[c]pyran-3(1H)-one,octahydro-4,4-dimethyl |
| 4,4-dimethyl-octahydro-cyclohepta[c]pyran-3-one |