Acetaldehyde,2-(2-hydroxyethoxy)-, 2-(2,4-dinitrophenyl)hydrazone structure
|
Common Name | Acetaldehyde,2-(2-hydroxyethoxy)-, 2-(2,4-dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 6963-08-2 | Molecular Weight | 284.22500 | |
| Density | 1.503g/cm3 | Boiling Point | 490.118ºC at 760 mmHg | |
| Molecular Formula | C10H12N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.215ºC | |
| Name | 2-[(2E)-2-[(2,4-dinitrophenyl)hydrazinylidene]ethoxy]ethanol |
|---|
| Density | 1.503g/cm3 |
|---|---|
| Boiling Point | 490.118ºC at 760 mmHg |
| Molecular Formula | C10H12N4O6 |
| Molecular Weight | 284.22500 |
| Flash Point | 250.215ºC |
| Exact Mass | 284.07600 |
| PSA | 145.49000 |
| LogP | 2.02900 |
| Index of Refraction | 1.612 |
| InChIKey | NJAFOBOHRWYHBL-QDEBKDIKSA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=CCOCCO)c([N+](=O)[O-])c1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |