1,3-Benzenediol,1,3-dipropanoate structure
|
Common Name | 1,3-Benzenediol,1,3-dipropanoate | ||
|---|---|---|---|---|
| CAS Number | 6963-54-8 | Molecular Weight | 222.23700 | |
| Density | 1.124g/cm3 | Boiling Point | 310.6ºC at 760mmHg | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.5ºC | |
| Name | (3-propanoyloxyphenyl) propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.124g/cm3 |
|---|---|
| Boiling Point | 310.6ºC at 760mmHg |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.23700 |
| Flash Point | 150.5ºC |
| Exact Mass | 222.08900 |
| PSA | 52.60000 |
| LogP | 2.31740 |
| Index of Refraction | 1.5 |
| InChIKey | UKDWCDFYKUAITL-UHFFFAOYSA-N |
| SMILES | CCC(=O)Oc1cccc(OC(=O)CC)c1 |
|
~%
1,3-Benzenediol... CAS#:6963-54-8 |
| Literature: du Pont de Nemours and Co. Patent: US2467206 , 1945 ; |
|
~%
1,3-Benzenediol... CAS#:6963-54-8 |
| Literature: Gerzenstein de Mittelman Anales de la Asociacion Quimica Argentina (1921-2001), 1944 , vol. 32, p. 84,87 |
|
~%
1,3-Benzenediol... CAS#:6963-54-8
Learn More
|
| Literature: Israelstam; Simpson Journal of the South African Chemical Institute, 1956 , vol. 9, p. 92 |
|
~%
1,3-Benzenediol... CAS#:6963-54-8 |
| Literature: Wittig Chemische Berichte, 1926 , vol. 59, p. 117 |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1,3-bis-piperidinomethyl-imidazolidine-2-thione |
| 1,3-Bis-piperidinomethyl-imidazolidin-2-thion |
| 1,3-diphosphoglycerate |
| glyceric acid 1,3-biphosphate |
| resorcinol dipropanoate |
| 1,3-Bis-propionyloxy-benzol |
| 1,3-Diphosphoglycerinsaeure |
| m-Phenylen-dipropionat |
| Glyceric acid-1,3-diphosphate |
| glycerate 1,3-biphosphate |
| 1,3-Biphosphoglyceric acid |
| P-glyceroyl-P |
| 3-Phosphoglyceroyl phosphate |
| 1,3-bis-propionyloxy-benzene |
| Resorcindipropionat |
| 1,3-bis-piperidin-1-ylmethyl-imidazolidine-2-thione |
| Di-O-propionyl-resorcin |
| 1,3-Bisphosphoglycerate |
| 1.3-Dipropionyloxy-benzol |
| 3-Phosphoglyceroyl-phosphat |
| 1,3-biphosphoglycerate |