2-(ethoxycarbonylamino)butanedioic acid structure
|
Common Name | 2-(ethoxycarbonylamino)butanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 6965-27-1 | Molecular Weight | 205.16500 | |
| Density | 1.405g/cm3 | Boiling Point | 373.4ºC at 760 mmHg | |
| Molecular Formula | C7H11NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.6ºC | |
| Name | 2-(ethoxycarbonylamino)butanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.405g/cm3 |
|---|---|
| Boiling Point | 373.4ºC at 760 mmHg |
| Molecular Formula | C7H11NO6 |
| Molecular Weight | 205.16500 |
| Flash Point | 179.6ºC |
| Exact Mass | 205.05900 |
| PSA | 112.93000 |
| LogP | 0.05130 |
| Index of Refraction | 1.499 |
| InChIKey | FJENCEURQYNZHL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC(CC(=O)O)C(=O)O |
|
~60%
2-(ethoxycarbon... CAS#:6965-27-1 |
| Literature: Stefanowicz, Piotr; Jaremko, Lukasz; Jaremko, Mariusz; Lis, Tadeusz New Journal of Chemistry, 2006 , vol. 30, # 2 p. 258 - 265 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| carboethoxy-L-aspartic acid |
| Aspartic acid,N-ethyl ester,L |